CAS 40226-95-7 appears in our catalog under these names: Cis-tetrahydro-1h-thieno[3,4-d]imidazol-2(3h)-one 5,5-dioxide, 95%, cis-Tetrahydro-1H-thieno(3,4-d)imidazol-2(3H)-one 5,5-dioxide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(3aS,6aR)-5,5-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (CAS 40226-95-7) is a chemical compound with the molecular formula C5H8N2O3S and a molecular weight of 176.20 g/mol. IUPAC name: (3aS,6aR)-5,5-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one. InChIKey: ZDWQNWWGFIYOOO-ZXZARUISSA-N.
| Molecular formula | C5H8N2O3S |
|---|---|
| Molecular weight | 176.20 g/mol |
| IUPAC name | (3aS,6aR)-5,5-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| InChIKey | ZDWQNWWGFIYOOO-ZXZARUISSA-N |
| SMILES | C1[C@@H]2[C@H](CS1(=O)=O)NC(=O)N2 |
Computed by PubChem (NCBI)