CAS 89280-34-2 appears in our catalog under these names: 3,5-Dimethyl-1H-pyrazole-4-sulfonic acid, 95%, 3,5-Dimethyl-1H-pyrazole-4-sulfonic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3,5-dimethyl-1H-pyrazole-4-sulfonic acid (CAS 89280-34-2) is a chemical compound with the molecular formula C5H8N2O3S and a molecular weight of 176.20 g/mol. IUPAC name: 3,5-dimethyl-1H-pyrazole-4-sulfonic acid. InChIKey: XWDFGELFGLFBNB-UHFFFAOYSA-N.
| Molecular formula | C5H8N2O3S |
|---|---|
| Molecular weight | 176.20 g/mol |
| IUPAC name | 3,5-dimethyl-1H-pyrazole-4-sulfonic acid |
| InChIKey | XWDFGELFGLFBNB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)O |
Computed by PubChem (NCBI)