CAS 402497-81-8 appears in our catalog under these names: Ac-phe(4-nh2)-oh, 97%, (S)-2-Acetamido-3-(4-aminophenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 25g, 1g.
(2S)-2-acetamido-3-(4-aminophenyl)propanoic acid (CAS 402497-81-8) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: (2S)-2-acetamido-3-(4-aminophenyl)propanoic acid. InChIKey: FEQBTHHWQQXZTN-JTQLQIEISA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(4-aminophenyl)propanoic acid |
| InChIKey | FEQBTHHWQQXZTN-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)N)C(=O)O |
Computed by PubChem (NCBI)