Products 40306-75-0

CAS 40306-75-0 is the registry number for 3-Acetamido-5-amino-4-hydroxybenzenesulfonic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

3-acetamido-5-amino-4-hydroxybenzenesulfonic acid (CAS 40306-75-0) is a chemical compound with the molecular formula C8H10N2O5S and a molecular weight of 246.24 g/mol. IUPAC name: 3-acetamido-5-amino-4-hydroxybenzenesulfonic acid. InChIKey: SFUJTLIHMWZDTL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O5S
Molecular weight246.24 g/mol
IUPAC name3-acetamido-5-amino-4-hydroxybenzenesulfonic acid
InChIKeySFUJTLIHMWZDTL-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC(=CC(=C1O)N)S(=O)(=O)O

Computed by PubChem (NCBI)