CAS 42247-91-6 appears in our catalog under these names: 4-Hydroxy-N,N-dimethyl-3-nitrobenzenesulfonamide, 98%, 4-Hydroxy-N,N-dimethyl-3-nitrobenzene-1-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
4-hydroxy-N,N-dimethyl-3-nitrobenzenesulfonamide (CAS 42247-91-6) is a chemical compound with the molecular formula C8H10N2O5S and a molecular weight of 246.24 g/mol. IUPAC name: 4-hydroxy-N,N-dimethyl-3-nitrobenzenesulfonamide. InChIKey: WSOMANNJPFZGIH-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O5S |
|---|---|
| Molecular weight | 246.24 g/mol |
| IUPAC name | 4-hydroxy-N,N-dimethyl-3-nitrobenzenesulfonamide |
| InChIKey | WSOMANNJPFZGIH-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)