CAS 40312-29-6 is the registry number for 3-Benzoyl-4H,5H,6H-cyclopenta(b)thiophen-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-phenylmethanone (CAS 40312-29-6) is a chemical compound with the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. IUPAC name: (2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-phenylmethanone. InChIKey: ZIOVYNKDBMOAMM-UHFFFAOYSA-N.
| Molecular formula | C14H13NOS |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | (2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-phenylmethanone |
| InChIKey | ZIOVYNKDBMOAMM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C(=O)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)