CAS 950025-59-9 is the registry number for N-Phenyl-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-phenyl-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide (CAS 950025-59-9) is a chemical compound with the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. IUPAC name: N-phenyl-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide. InChIKey: ZDAAIRJNQXMTSO-UHFFFAOYSA-N.
| Molecular formula | C14H13NOS |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | N-phenyl-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
| InChIKey | ZDAAIRJNQXMTSO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2)C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)