CAS 40320-62-5 appears in our catalog under these names: 1-(Diphenylmethyl)-3-phenyl-3-azetidinol, 95%, 1-Benzhydryl-3-phenylazetidin-3-ol, 95+%, 1–(Diphenylmethyl)–3–Phenyl–3–Azetidinol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-benzhydryl-3-phenylazetidin-3-ol (CAS 40320-62-5) is a chemical compound with the molecular formula C22H21NO and a molecular weight of 315.4 g/mol. IUPAC name: 1-benzhydryl-3-phenylazetidin-3-ol. InChIKey: ZEYWZZWPRDEWHR-UHFFFAOYSA-N.
| Molecular formula | C22H21NO |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 1-benzhydryl-3-phenylazetidin-3-ol |
| InChIKey | ZEYWZZWPRDEWHR-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(C2=CC=CC=C2)C3=CC=CC=C3)(C4=CC=CC=C4)O |
Computed by PubChem (NCBI)