CAS 53704-23-7 is the registry number for (2E)-2-[(2E)-2-(1,3,3-Trimethyl-1,3-dihydro-2h-indol-2-ylidene)ethylidene]indan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(2E)-2-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one (CAS 53704-23-7) is a chemical compound with the molecular formula C22H21NO and a molecular weight of 315.4 g/mol. IUPAC name: (2E)-2-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one. InChIKey: RMZNRQVMHQVFHH-GEEUODSKSA-N.
| Molecular formula | C22H21NO |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | (2E)-2-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one |
| InChIKey | RMZNRQVMHQVFHH-GEEUODSKSA-N |
| SMILES | CC\1(C2=CC=CC=C2N(/C1=C/C=C/3\CC4=CC=CC=C4C3=O)C)C |
Computed by PubChem (NCBI)