Products 40345-47-9
CAS 40345-47-9 is the registry number for 2,3-di(hydroxyimino)-5,5-dimethylcyclohexan-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
2,3-bis(hydroxyimino)-5,5-dimethylcyclohexan-1-one (CAS 40345-47-9) is a chemical compound with the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. IUPAC name: 2,3-bis(hydroxyimino)-5,5-dimethylcyclohexan-1-one. InChIKey: YFSCVZVLHXMHFB-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O3 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2,3-bis(hydroxyimino)-5,5-dimethylcyclohexan-1-one |
| InChIKey | YFSCVZVLHXMHFB-UHFFFAOYSA-N |
| SMILES | CC1(CC(=NO)C(=NO)C(=O)C1)C |
Computed by PubChem (NCBI)