CAS 403502-85-2 appears in our catalog under these names: Methylphenidate Impurity 1, trans-7-Phenyl-1-azabicyclo(4.2.0)octan-8-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(6R,7S)-7-phenyl-1-azabicyclo[4.2.0]octan-8-one (CAS 403502-85-2) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: (6R,7S)-7-phenyl-1-azabicyclo[4.2.0]octan-8-one. InChIKey: BGCURPUAMJAFSI-NEPJUHHUSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | (6R,7S)-7-phenyl-1-azabicyclo[4.2.0]octan-8-one |
| InChIKey | BGCURPUAMJAFSI-NEPJUHHUSA-N |
| SMILES | C1CCN2[C@H](C1)[C@@H](C2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)