Products 4036-30-0
CAS 4036-30-0 appears in our catalog under these names: (S)–(+)–Phenylsuccinic Acid, (S)-(+)-Phenylsuccinic Acid, >98.0%(T)(HPLC), (S)-2-Phenylsuccinic acid 98%, (S)-2-Phenylsuccinic acid, 97%, 97%, (S)-2-Phenyl succinic acid, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g, 10g.
(2S)-2-phenylbutanedioic acid (CAS 4036-30-0) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: (2S)-2-phenylbutanedioic acid. InChIKey: LVFFZQQWIZURIO-QMMMGPOBSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2S)-2-phenylbutanedioic acid |
| InChIKey | LVFFZQQWIZURIO-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(+)-Phenylsuccinic acid, (S)-2-phenylsuccinic acid, (S)-(+)-Phenylsuccinic acid, (2S)-2-phenylbutanedioic acid, (S)-2-Phenyl succinic acid, (S)-Phenylsuccinic acid, (2S)-2-phenylbutanedioic acid >99% ee, (S)-(+)-Phenylsuccinic acid, >=99.0% (sum of enantiomers, HPLC), (S)-2-Phenylsuccinicacid, Butanedioic acid, phenyl-, (2S)-