CAS 40368-97-6 is the registry number for 1H-Benzo[4,5]thieno[2,3-b]pyrrole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3H-[1]benzothiolo[2,3-b]pyrrole (CAS 40368-97-6) is a chemical compound with the molecular formula C10H7NS and a molecular weight of 173.24 g/mol. IUPAC name: 3H-[1]benzothiolo[2,3-b]pyrrole. InChIKey: MHBACGMHNXFPOK-UHFFFAOYSA-N.
| Molecular formula | C10H7NS |
|---|---|
| Molecular weight | 173.24 g/mol |
| IUPAC name | 3H-[1]benzothiolo[2,3-b]pyrrole |
| InChIKey | MHBACGMHNXFPOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)NC=C3 |
Computed by PubChem (NCBI)