CAS 75444-80-3 appears in our catalog under these names: Benzo[b]thiophene-2-acetonitrile, 96%, 2-(1-Benzothiophen-2-yl)acetonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
2-(1-benzothiophen-2-yl)acetonitrile (CAS 75444-80-3) is a chemical compound with the molecular formula C10H7NS and a molecular weight of 173.24 g/mol. IUPAC name: 2-(1-benzothiophen-2-yl)acetonitrile. InChIKey: SPJJYCYYBXUZCP-UHFFFAOYSA-N.
| Molecular formula | C10H7NS |
|---|---|
| Molecular weight | 173.24 g/mol |
| IUPAC name | 2-(1-benzothiophen-2-yl)acetonitrile |
| InChIKey | SPJJYCYYBXUZCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)CC#N |
Computed by PubChem (NCBI)