Products 403724-67-4
CAS 403724-67-4 is the registry number for 2-Phenylpyridine-d9. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)pyridine (CAS 403724-67-4) is a chemical compound with the molecular formula C11H9N and a molecular weight of 164.25 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)pyridine. InChIKey: VQGHOUODWALEFC-LOIXRAQWSA-N.
| Molecular formula | C11H9N |
|---|---|
| Molecular weight | 164.25 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)pyridine |
| InChIKey | VQGHOUODWALEFC-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=N2)[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)