CAS 4038-13-5 appears in our catalog under these names: (2,5-Dimethoxyphenyl)(phenyl)methanone, 97%, (2,5-Dimethoxyphenyl)(phenyl)methanone. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2,5-dimethoxyphenyl)-phenylmethanone (CAS 4038-13-5) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: (2,5-dimethoxyphenyl)-phenylmethanone. InChIKey: PKEAHRFPMAHKBR-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | (2,5-dimethoxyphenyl)-phenylmethanone |
| InChIKey | PKEAHRFPMAHKBR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)