CAS 4038-14-6 appears in our catalog under these names: 3,4-Dimethoxybenzophenone, 98%, (3,4–Dimethoxyphenyl)(phenyl)methanone, 3,4-Dimethoxybenzophenone, (3,4-Dimethoxyphenyl)(phenyl)methanone 98%, (3,4-Dimethoxyphenyl)(phenyl)methanone, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 500g, 0,5kg, 0,25kg, 1kg, 10g.
(3,4-dimethoxyphenyl)-phenylmethanone (CAS 4038-14-6) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: (3,4-dimethoxyphenyl)-phenylmethanone. InChIKey: WCNOATOQNSHEFK-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | (3,4-dimethoxyphenyl)-phenylmethanone |
| InChIKey | WCNOATOQNSHEFK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)