Products 40421-52-1
CAS 40421-52-1 appears in our catalog under these names: Erythro-1-phenylpropane-1,2-diol, (1R,2S)-1-Phenylpropane-1,2-diol. Offered by: MedChemExpress, Biosynth. Available pack sizes: Get quote, 10mg, 5mg, 25mg, 50mg.
(1R,2S)-1-phenylpropane-1,2-diol (CAS 40421-52-1) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. IUPAC name: (1R,2S)-1-phenylpropane-1,2-diol. InChIKey: MZQZXSHFWDHNOW-CBAPKCEASA-N.
| Molecular formula | C9H12O2 |
|---|---|
| Molecular weight | 152.19 g/mol |
| IUPAC name | (1R,2S)-1-phenylpropane-1,2-diol |
| InChIKey | MZQZXSHFWDHNOW-CBAPKCEASA-N |
| SMILES | C[C@@H]([C@@H](C1=CC=CC=C1)O)O |
Computed by PubChem (NCBI)