CAS 40434-87-5 appears in our catalog under these names: (R)–(–)–2–Hydroxy–2–phenylethyl p–toluenesulfonate, (R)-2-Hydroxy-2-phenylethyl 4-methylbenzenesulfonate 98%, 1,2-Ethanediol, 1-phenyl-, 2-(4-methylbenzenesulfonate), (1R)-, 98%, 98%, (R)-2-Hydroxy-2-phenylethyl 4-methylbenzenesulfonate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg.
[(2R)-2-hydroxy-2-phenylethyl] 4-methylbenzenesulfonate (CAS 40434-87-5) is a chemical compound with the molecular formula C15H16O4S and a molecular weight of 292.4 g/mol. IUPAC name: [(2R)-2-hydroxy-2-phenylethyl] 4-methylbenzenesulfonate. InChIKey: IOTJIFRGXYQHAQ-HNNXBMFYSA-N.
| Molecular formula | C15H16O4S |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | [(2R)-2-hydroxy-2-phenylethyl] 4-methylbenzenesulfonate |
| InChIKey | IOTJIFRGXYQHAQ-HNNXBMFYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)