CAS 40435-14-1 appears in our catalog under these names: (S)–(+)–1–Phenyl–1,2–ethanediol 2–tosylate, (S)-2-Hydroxy-2-phenylethyl 4-methylbenzenesulfonate 98%, (S)-(+)-1-Phenyl-1,2-ethanediol 2-tosylate, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
[(2S)-2-hydroxy-2-phenylethyl] 4-methylbenzenesulfonate (CAS 40435-14-1) is a chemical compound with the molecular formula C15H16O4S and a molecular weight of 292.4 g/mol. IUPAC name: [(2S)-2-hydroxy-2-phenylethyl] 4-methylbenzenesulfonate. InChIKey: IOTJIFRGXYQHAQ-OAHLLOKOSA-N.
| Molecular formula | C15H16O4S |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | [(2S)-2-hydroxy-2-phenylethyl] 4-methylbenzenesulfonate |
| InChIKey | IOTJIFRGXYQHAQ-OAHLLOKOSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)