Products 404376-07-4
CAS 404376-07-4 appears in our catalog under these names: 2-[(3-Bromobenzene)amido]benzoic acid, 95%, 2-(3-Bromobenzamido)benzoic acid, 2-(3-Bromobenzamido)benzoic acid, 90%, 90%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 100mg.
2-[(3-bromobenzoyl)amino]benzoic acid (CAS 404376-07-4) is a chemical compound with the molecular formula C14H10BrNO3 and a molecular weight of 320.14 g/mol. IUPAC name: 2-[(3-bromobenzoyl)amino]benzoic acid. InChIKey: WUBKINCNCAVQLY-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNO3 |
|---|---|
| Molecular weight | 320.14 g/mol |
| IUPAC name | 2-[(3-bromobenzoyl)amino]benzoic acid |
| InChIKey | WUBKINCNCAVQLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)