CAS 52559-37-2 appears in our catalog under these names: 6-BROMO-2-(2-HYDROXYETHYL)-1H-BENZO[DE]ISOQUINOLINE-1,3(2H)-DIONE, 97%, 6-Bromo-2-(2-hydroxyethyl)-1H-benzo[de]isoquinoline-1,3(2H)-dione, 97%, 97%, 4-Bromo-n-(2-hydroxyethyl)-1,8-naphthalimide, 95%. Offered by: Fluorochem, Chemat, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
6-bromo-2-(2-hydroxyethyl)benzo[de]isoquinoline-1,3-dione (CAS 52559-37-2) is a chemical compound with the molecular formula C14H10BrNO3 and a molecular weight of 320.14 g/mol. IUPAC name: 6-bromo-2-(2-hydroxyethyl)benzo[de]isoquinoline-1,3-dione. InChIKey: OFYBUNRNPXLEFK-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNO3 |
|---|---|
| Molecular weight | 320.14 g/mol |
| IUPAC name | 6-bromo-2-(2-hydroxyethyl)benzo[de]isoquinoline-1,3-dione |
| InChIKey | OFYBUNRNPXLEFK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)N(C3=O)CCO)Br |
Computed by PubChem (NCBI)