Products 4044-54-6
CAS 4044-54-6 appears in our catalog under these names: 2,3-Dihydro-1h-indene-4-carboxylic acid, 95%, 2，3–Dihydro–1H–indene–4–carboxylic acid, 2,3-Dihydro-1H-indene-4-carboxylic acid, 2,3-Dihydro-1H-indene-4-carboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 2,5g, 5g, 10g.
2,3-dihydro-1H-indene-4-carboxylic acid (CAS 4044-54-6) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: 2,3-dihydro-1H-indene-4-carboxylic acid. InChIKey: QJQQSHWSGOMJDZ-UHFFFAOYSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | 2,3-dihydro-1H-indene-4-carboxylic acid |
| InChIKey | QJQQSHWSGOMJDZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)