CAS 40484-56-8 is the registry number for 6,8-Dinitro-1,2,3,4-tetrahydroquinoline. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
6,8-dinitro-1,2,3,4-tetrahydroquinoline (CAS 40484-56-8) is a chemical compound with the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. IUPAC name: 6,8-dinitro-1,2,3,4-tetrahydroquinoline. InChIKey: XCLHEQIACBUGJP-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O4 |
|---|---|
| Molecular weight | 223.19 g/mol |
| IUPAC name | 6,8-dinitro-1,2,3,4-tetrahydroquinoline |
| InChIKey | XCLHEQIACBUGJP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)[N+](=O)[O-])[N+](=O)[O-])NC1 |
Computed by PubChem (NCBI)