CAS 676335-98-1 is the registry number for N-(Benzo[d][1,3]dioxol-5-yl)-2-hydrazineyl-2-oxoacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,3-benzodioxol-5-yl)-2-hydrazinyl-2-oxoacetamide (CAS 676335-98-1) is a chemical compound with the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. IUPAC name: N-(1,3-benzodioxol-5-yl)-2-hydrazinyl-2-oxoacetamide. InChIKey: AYYFRBPVEVPCIA-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O4 |
|---|---|
| Molecular weight | 223.19 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-yl)-2-hydrazinyl-2-oxoacetamide |
| InChIKey | AYYFRBPVEVPCIA-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=O)C(=O)NN |
Computed by PubChem (NCBI)