Products 404913-16-2

CAS 404913-16-2 is the registry number for methyl 2-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (CAS 404913-16-2) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: methyl 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate. InChIKey: UYFWJTXPOHBQKB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N2O2
Molecular weight244.29 g/mol
IUPAC namemethyl 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate
InChIKeyUYFWJTXPOHBQKB-UHFFFAOYSA-N
SMILESCN1CCC2=C(C1)C3=C(N2)C=CC(=C3)C(=O)OC

Computed by PubChem (NCBI)