CAS 404958-10-7 is the registry number for Rosuvastatin Impurity 185. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R)-3-hydroxy-4-[(2S)-oxiran-2-yl]butanoate (CAS 404958-10-7) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl (3R)-3-hydroxy-4-[(2S)-oxiran-2-yl]butanoate. InChIKey: LXXBXPOLFXCFEB-SFYZADRCSA-N.
| Molecular formula | C10H18O4 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl (3R)-3-hydroxy-4-[(2S)-oxiran-2-yl]butanoate |
| InChIKey | LXXBXPOLFXCFEB-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C[C@H]1CO1)O |
Computed by PubChem (NCBI)