Products 40514-91-8
CAS 40514-91-8 is the registry number for Cefoxitin Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (6R,7S)-7-amino-7-methoxy-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (CAS 40514-91-8) is a chemical compound with the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. IUPAC name: tert-butyl (6R,7S)-7-amino-7-methoxy-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate. InChIKey: DVSNPKXXPGXFLD-YPMHNXCESA-N.
| Molecular formula | C13H20N2O4S |
|---|---|
| Molecular weight | 300.38 g/mol |
| IUPAC name | tert-butyl (6R,7S)-7-amino-7-methoxy-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| InChIKey | DVSNPKXXPGXFLD-YPMHNXCESA-N |
| SMILES | CC1=C(N2[C@@H]([C@@](C2=O)(N)OC)SC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)