CAS 2130-76-9 appears in our catalog under these names: H-Lys(tos)-oh, 95%, (S)-2-Amino-6-(4-methylphenylsulfonamido)hexanoic acid, 95+%, (S)–2–Amino–6–(4–methylphenylsulfonamido)hexanoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(2S)-2-amino-6-[(4-methylphenyl)sulfonylamino]hexanoic acid (CAS 2130-76-9) is a chemical compound with the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. IUPAC name: (2S)-2-amino-6-[(4-methylphenyl)sulfonylamino]hexanoic acid. InChIKey: FRJAAXSHLGSWAP-LBPRGKRZSA-N.
| Molecular formula | C13H20N2O4S |
|---|---|
| Molecular weight | 300.38 g/mol |
| IUPAC name | (2S)-2-amino-6-[(4-methylphenyl)sulfonylamino]hexanoic acid |
| InChIKey | FRJAAXSHLGSWAP-LBPRGKRZSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCCCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)