CAS 1042503-62-7 appears in our catalog under these names: 5-{(3-(dimethylamino)propyl)sulfamoyl}-2-methylbenzoic acid, 95%, 5-{(3-(Dimethylamino)propyl)sulfamoyl}-2-methylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
5-[3-(dimethylamino)propylsulfamoyl]-2-methylbenzoic acid (CAS 1042503-62-7) is a chemical compound with the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. IUPAC name: 5-[3-(dimethylamino)propylsulfamoyl]-2-methylbenzoic acid. InChIKey: FTWHLARTWMVCMQ-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O4S |
|---|---|
| Molecular weight | 300.38 g/mol |
| IUPAC name | 5-[3-(dimethylamino)propylsulfamoyl]-2-methylbenzoic acid |
| InChIKey | FTWHLARTWMVCMQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NCCCN(C)C)C(=O)O |
Computed by PubChem (NCBI)