CAS 405873-05-4 appears in our catalog under these names: (3R)-(-)-3-(1-methyl-1h-indol-3-yl)-1-butyraldehyde, 95%, (3R)–(–)–3–(1–Methyl–1H–indol–3–yl)butyraldehyde, (3R)-(-)-3-(1-METHYL-1H-INDOL-3-YL)BUTY&. Offered by: Chemat Brand, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 1g, 250mg, 50mg.
(3R)-3-(1-methylindol-3-yl)butanal (CAS 405873-05-4) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: (3R)-3-(1-methylindol-3-yl)butanal. InChIKey: OQWWHYBHQFZHLP-SNVBAGLBSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | (3R)-3-(1-methylindol-3-yl)butanal |
| InChIKey | OQWWHYBHQFZHLP-SNVBAGLBSA-N |
| SMILES | C[C@H](CC=O)C1=CN(C2=CC=CC=C21)C |
Computed by PubChem (NCBI)