CAS 405889-73-8 is the registry number for 4-(4-Chlorophenyl)-4-ethyl-2,6-dioxopiperidine-3,5-dicarbonitrile, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-(4-chlorophenyl)-4-ethyl-2,6-dioxopiperidine-3,5-dicarbonitrile (CAS 405889-73-8) is a chemical compound with the molecular formula C15H12ClN3O2 and a molecular weight of 301.73 g/mol. IUPAC name: 4-(4-chlorophenyl)-4-ethyl-2,6-dioxopiperidine-3,5-dicarbonitrile. InChIKey: QJBGSLYPNWSFGM-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3O2 |
|---|---|
| Molecular weight | 301.73 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-4-ethyl-2,6-dioxopiperidine-3,5-dicarbonitrile |
| InChIKey | QJBGSLYPNWSFGM-UHFFFAOYSA-N |
| SMILES | CCC1(C(C(=O)NC(=O)C1C#N)C#N)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)