Products 915945-31-2
CAS 915945-31-2 is the registry number for N-(3-Chloro-4-(pyridin-2-ylmethoxy)phenyl)-2-cyanoacetamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-2-cyanoacetamide (CAS 915945-31-2) is a chemical compound with the molecular formula C15H12ClN3O2 and a molecular weight of 301.73 g/mol. IUPAC name: N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-2-cyanoacetamide. InChIKey: DDGCLMQPAIQRMN-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3O2 |
|---|---|
| Molecular weight | 301.73 g/mol |
| IUPAC name | N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-2-cyanoacetamide |
| InChIKey | DDGCLMQPAIQRMN-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)COC2=C(C=C(C=C2)NC(=O)CC#N)Cl |
Computed by PubChem (NCBI)