Products 40597-69-1

CAS 40597-69-1 is the registry number for 3,4-Dihydrodibenzo(b,d)furan-1(2H)-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

3,4-dihydro-2H-dibenzofuran-1-one (CAS 40597-69-1) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 3,4-dihydro-2H-dibenzofuran-1-one. InChIKey: AVGBRRURGOWLFS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10O2
Molecular weight186.21 g/mol
IUPAC name3,4-dihydro-2H-dibenzofuran-1-one
InChIKeyAVGBRRURGOWLFS-UHFFFAOYSA-N
SMILESC1CC2=C(C(=O)C1)C3=CC=CC=C3O2

Computed by PubChem (NCBI)