CAS 40775-95-9 appears in our catalog under these names: 5-Methyl-2-(methylsulfonyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-ol, 95%, 5–Methyl–2–(methylsulfonyl)–(1,2,4)triazolo(1,5–a)pyrimidin–7–ol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
5-methyl-2-methylsulfonyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 40775-95-9) is a chemical compound with the molecular formula C7H8N4O3S and a molecular weight of 228.23 g/mol. IUPAC name: 5-methyl-2-methylsulfonyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: MSIGCTXGGJXOQS-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O3S |
|---|---|
| Molecular weight | 228.23 g/mol |
| IUPAC name | 5-methyl-2-methylsulfonyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | MSIGCTXGGJXOQS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)N=C(N2)S(=O)(=O)C |
Computed by PubChem (NCBI)