CAS 90000-59-2 is the registry number for 5–Methyl–2–(methylsulfonyl)–(1,2,4)triazolo(1,5–a)pyrimidin–7(1H)–one. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
5-methyl-2-methylsulfonyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 90000-59-2) is a chemical compound with the molecular formula C7H8N4O3S and a molecular weight of 228.23 g/mol. IUPAC name: 5-methyl-2-methylsulfonyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: MSIGCTXGGJXOQS-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O3S |
|---|---|
| Molecular weight | 228.23 g/mol |
| IUPAC name | 5-methyl-2-methylsulfonyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | MSIGCTXGGJXOQS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)N=C(N2)S(=O)(=O)C |
Computed by PubChem (NCBI)