Products 4079-62-3
CAS 4079-62-3 appears in our catalog under these names: D,L-Aspartic acid dibenzyl ester-p-toluenesulfonate, 98%, Dibenzyl aspartate 4–methylbenzenesulfonate, H-DL-Asp(OBzl)-OBzl P-Tosylate 98%, Dibenzyl 2-aminosuccinate 4-methylbenzenesulfonate, 98%, 98%, Dibenzyl aspartate 4-methylbenzenesulfonate, 97.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 25g, 500g, 100g, 5g, 1g, 10g, 25 g, 100 g.
Dibenzyl 2-aminobutanedioate;4-methylbenzenesulfonic acid (CAS 4079-62-3) is a chemical compound with the molecular formula C25H27NO7S and a molecular weight of 485.6 g/mol. IUPAC name: dibenzyl 2-aminobutanedioate;4-methylbenzenesulfonic acid. InChIKey: HLMUYZYLPUHSNV-UHFFFAOYSA-N.
| Molecular formula | C25H27NO7S |
|---|---|
| Molecular weight | 485.6 g/mol |
| IUPAC name | dibenzyl 2-aminobutanedioate;4-methylbenzenesulfonic acid |
| InChIKey | HLMUYZYLPUHSNV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC(=O)CC(C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)
Synonyms:
1,2-Bis(benzyloxycarbonyl)ethylammonium toluene-p-sulphonate, L-Aspartic acid, bis(phenylmethyl) ester, 4-methylbenzenesulfonate, D,L-Aspartic acid dibenzyl ester-p-toluenesulfonate, Dibenzyl aspartate 4-methylbenzenesulfonate, (r)-dibenzyl 2-aminosuccinate 4-methylbenzenesulfonate, h-asp(obzl)-obzl tosoh, dibenzyl 2-aminobutanedioate;4-methylbenzenesulfonic acid, 1,4-dibenzyl 2-aminobutanedioate; 4-methylbenzene-1-sulfonic acid, h-d-asp(obzl)-obzl tos, H-Asp(OBzl)-OBzl.Tos