CAS 4079-64-5 appears in our catalog under these names: D-Aspartic acid dibenzyl ester-p-toluenesulfonate, 98%, H–D–Asp(OBzl)–OBzl?TosOH, H-D-Asp(OBzl)-OBzl·TosOH 98%, H-D-Asp(OBzl)-OBzl.TosOH, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g.
Dibenzyl (2R)-2-aminobutanedioate;4-methylbenzenesulfonic acid (CAS 4079-64-5) is a chemical compound with the molecular formula C25H27NO7S and a molecular weight of 485.6 g/mol. IUPAC name: dibenzyl (2R)-2-aminobutanedioate;4-methylbenzenesulfonic acid. InChIKey: HLMUYZYLPUHSNV-PKLMIRHRSA-N.
| Molecular formula | C25H27NO7S |
|---|---|
| Molecular weight | 485.6 g/mol |
| IUPAC name | dibenzyl (2R)-2-aminobutanedioate;4-methylbenzenesulfonic acid |
| InChIKey | HLMUYZYLPUHSNV-PKLMIRHRSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC(=O)C[C@H](C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)