CAS 408312-39-0 is the registry number for 5-Ethoxy-1-methyl-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-ethoxy-1-methylindole (CAS 408312-39-0) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 5-ethoxy-1-methylindole. InChIKey: ABTJVCRBFLFVQJ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 5-ethoxy-1-methylindole |
| InChIKey | ABTJVCRBFLFVQJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)N(C=C2)C |
Computed by PubChem (NCBI)