CAS 40897-41-4 appears in our catalog under these names: 3-[(3-aminophenyl)disulfanyl]aniline, 96%, 3,3'-Disulfanediyldianiline, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
3-[(3-aminophenyl)disulfanyl]aniline (CAS 40897-41-4) is a chemical compound with the molecular formula C12H12N2S2 and a molecular weight of 248.4 g/mol. IUPAC name: 3-[(3-aminophenyl)disulfanyl]aniline. InChIKey: HZCSIYBMJICNFY-UHFFFAOYSA-N.
| Molecular formula | C12H12N2S2 |
|---|---|
| Molecular weight | 248.4 g/mol |
| IUPAC name | 3-[(3-aminophenyl)disulfanyl]aniline |
| InChIKey | HZCSIYBMJICNFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)SSC2=CC=CC(=C2)N)N |
Computed by PubChem (NCBI)