CAS 852706-22-0 is the registry number for 2-(4-(4-Methylphenyl)-1,3-thiazol-2-yl)ethanethioamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]ethanethioamide (CAS 852706-22-0) is a chemical compound with the molecular formula C12H12N2S2 and a molecular weight of 248.4 g/mol. IUPAC name: 2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]ethanethioamide. InChIKey: TYNXSOIJPOGOIE-UHFFFAOYSA-N.
| Molecular formula | C12H12N2S2 |
|---|---|
| Molecular weight | 248.4 g/mol |
| IUPAC name | 2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]ethanethioamide |
| InChIKey | TYNXSOIJPOGOIE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=N2)CC(=S)N |
Computed by PubChem (NCBI)