CAS 409-39-2 is the registry number for 5-chloro-3-nitropyridin-2-amine, 94%, 94%. Offered by: Chemat. Available pack sizes: 1g, 5g.
5-chloro-3-nitropyridin-2-amine (CAS 409-39-2) is a chemical compound with the molecular formula C5H4ClN3O2 and a molecular weight of 173.56 g/mol. IUPAC name: 5-chloro-3-nitropyridin-2-amine. InChIKey: GILTXHIJUUIMPI-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O2 |
|---|---|
| Molecular weight | 173.56 g/mol |
| IUPAC name | 5-chloro-3-nitropyridin-2-amine |
| InChIKey | GILTXHIJUUIMPI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1[N+](=O)[O-])N)Cl |
Computed by PubChem (NCBI)