CAS 4118-51-8 appears in our catalog under these names: Pregabalin EP Impurity D (Mandelic Acid Isopropyl Ester), Isopropyl DL-Mandelate, >95% (HPLC), Propan-2-yl (2RS)-2-Hydroxy-2-phenylacetate (Isopropyl Mandelate), Pregabalin EP Impurity D, Isopropyl 2-hydroxy-2-phenylacetate. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Ambeed. Available pack sizes: on request, 100mg, 1g, 25mg, 4x25mg, 0,1g, 0,05g, 0,25g.
Propan-2-yl 2-hydroxy-2-phenylacetate (CAS 4118-51-8) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: propan-2-yl 2-hydroxy-2-phenylacetate. InChIKey: SCJJMBMUZTUIJU-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | propan-2-yl 2-hydroxy-2-phenylacetate |
| InChIKey | SCJJMBMUZTUIJU-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(C1=CC=CC=C1)O |
Computed by PubChem (NCBI)