CAS 412017-24-4 is the registry number for 4-Hydroxy-3,6,10-trimethyl-5,9-undecadien-2-one. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
(5E)-4-hydroxy-3,6,10-trimethylundeca-5,9-dien-2-one (CAS 412017-24-4) is a chemical compound with the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. IUPAC name: (5E)-4-hydroxy-3,6,10-trimethylundeca-5,9-dien-2-one. InChIKey: JEBDYKNZHLBOMA-PKNBQFBNSA-N.
| Molecular formula | C14H24O2 |
|---|---|
| Molecular weight | 224.34 g/mol |
| IUPAC name | (5E)-4-hydroxy-3,6,10-trimethylundeca-5,9-dien-2-one |
| InChIKey | JEBDYKNZHLBOMA-PKNBQFBNSA-N |
| SMILES | CC(C(/C=C(\C)/CCC=C(C)C)O)C(=O)C |
Computed by PubChem (NCBI)