CAS 41266-78-8 is the registry number for 3-[(4-Chlorobenzyl)sulfanyl]-1h-1,2,4-triazol-5-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
3-[(4-chlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine (CAS 41266-78-8) is a chemical compound with the molecular formula C9H9ClN4S and a molecular weight of 240.71 g/mol. IUPAC name: 3-[(4-chlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine. InChIKey: FCBMSTGDFPBEMI-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4S |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | 3-[(4-chlorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-amine |
| InChIKey | FCBMSTGDFPBEMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSC2=NNC(=N2)N)Cl |
Computed by PubChem (NCBI)