CAS 733030-65-4 is the registry number for 5-Chloro-2-((4-methyl-4H-1,2,4-triazol-3-yl)sulfanyl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 10g.
5-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline (CAS 733030-65-4) is a chemical compound with the molecular formula C9H9ClN4S and a molecular weight of 240.71 g/mol. IUPAC name: 5-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline. InChIKey: ORIABKKRMMFJMW-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4S |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | 5-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline |
| InChIKey | ORIABKKRMMFJMW-UHFFFAOYSA-N |
| SMILES | CN1C=NN=C1SC2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)