CAS 41280-64-2 is the registry number for 4-(1,1-Dimethylethyl)-1,2-dimethoxybenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-tert-butyl-1,2-dimethoxybenzene (CAS 41280-64-2) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: 4-tert-butyl-1,2-dimethoxybenzene. InChIKey: FSWSUKGIUZLXKK-UHFFFAOYSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 4-tert-butyl-1,2-dimethoxybenzene |
| InChIKey | FSWSUKGIUZLXKK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)