CAS 412924-82-4 is the registry number for 2-Amino-2-(4-ethylphenyl)butanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-2-(4-ethylphenyl)butanoic acid (CAS 412924-82-4) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: 2-amino-2-(4-ethylphenyl)butanoic acid. InChIKey: BRRYTFILRTYCEY-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 2-amino-2-(4-ethylphenyl)butanoic acid |
| InChIKey | BRRYTFILRTYCEY-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(CC)(C(=O)O)N |
Computed by PubChem (NCBI)