Products 41295-20-9
CAS 41295-20-9 appears in our catalog under these names: 4–Amino–4'–methyldiphenyl Ether, 4-Amino-4'-methyldiphenyl Ether, >98.0%(T), 4-(p-Tolyloxy)aniline 98%, 4-Amino-4'-methyldiphenyl Ether, 98%, 98%, 4-Amino-4'-methyldiphenyl ether, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g.
4-(4-methylphenoxy)aniline (CAS 41295-20-9) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 4-(4-methylphenoxy)aniline. InChIKey: VPCGOYHSWIYEMO-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 4-(4-methylphenoxy)aniline |
| InChIKey | VPCGOYHSWIYEMO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)