CAS 4133-35-1 appears in our catalog under these names: 6–Bromo–2–tetralone, 6-Bromo-3,4-dihydronaphthalen-2(1H)-one, >98.0%(GC), 6-Bromo-2-tetralone, 98%, 6-Bromo-2-tetralone 98%, 6-BROMO-3,4-DIHYDRO-2(1H)-NAPHTHALENONE&. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 1g, 5g, 100mg, 25g, 50g, 100g, 250g.
6-bromo-3,4-dihydro-1H-naphthalen-2-one (CAS 4133-35-1) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-3,4-dihydro-1H-naphthalen-2-one. InChIKey: BYHKDUFPSJWJDI-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | BYHKDUFPSJWJDI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1=O)C=CC(=C2)Br |
Computed by PubChem (NCBI)